C16H13ClN2S2 — CID 79127898
3-[[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]aniline (PubChem CID 79127898) has the molecular formula C16H13ClN2S2 and a molecular weight of 332.88 g/mol. Its IUPAC name is 3-[[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]aniline.
| Compound Name | 3-[[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]aniline |
|---|---|
| PubChem CID | 79127898 |
| Molecular Formula | C16H13ClN2S2 |
| Molecular Weight | 332.88 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 3-[[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]aniline |
| SMILES | Nc1cccc(SCc2csc(-c3ccccc3Cl)n2)c1 |
| InChI | InChI=1S/C16H13ClN2S2/c17-15-7-2-1-6-14(15)16-19-12(10-21-16)9-20-13-5-3-4-11(18)8-13/h1-8,10H,9,18H2 |
| InChIKey | PAUOUHYYWMOOQQ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.88 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|