C16H14N2S2 — CID 71670229
3-[(4-phenyl-1,3-thiazol-2-yl)methylsulfanyl]aniline (PubChem CID 71670229) has the molecular formula C16H14N2S2 and a molecular weight of 298.44 g/mol. Its IUPAC name is 3-[(4-phenyl-1,3-thiazol-2-yl)methylsulfanyl]aniline.
| Compound Name | 3-[(4-phenyl-1,3-thiazol-2-yl)methylsulfanyl]aniline |
|---|---|
| PubChem CID | 71670229 |
| Molecular Formula | C16H14N2S2 |
| Molecular Weight | 298.44 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 3-[(4-phenyl-1,3-thiazol-2-yl)methylsulfanyl]aniline |
| SMILES | Nc1cccc(SCc2nc(-c3ccccc3)cs2)c1 |
| InChI | InChI=1S/C16H14N2S2/c17-13-7-4-8-14(9-13)19-11-16-18-15(10-20-16)12-5-2-1-3-6-12/h1-10H,11,17H2 |
| InChIKey | DMFCNIREXUMDPW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|