C16H13BrN2S2 — CID 66161211
4-[2-[(3-bromophenyl)sulfanylmethyl]-1,3-thiazol-4-yl]aniline (PubChem CID 66161211) has the molecular formula C16H13BrN2S2 and a molecular weight of 377.33 g/mol. Its IUPAC name is 4-[2-[(3-bromophenyl)sulfanylmethyl]-1,3-thiazol-4-yl]aniline.
| Compound Name | 4-[2-[(3-bromophenyl)sulfanylmethyl]-1,3-thiazol-4-yl]aniline |
|---|---|
| PubChem CID | 66161211 |
| Molecular Formula | C16H13BrN2S2 |
| Molecular Weight | 377.33 g/mol |
| Exact Mass | 375.97 |
| IUPAC Name | 4-[2-[(3-bromophenyl)sulfanylmethyl]-1,3-thiazol-4-yl]aniline |
| SMILES | Nc1ccc(-c2csc(CSc3cccc(Br)c3)n2)cc1 |
| InChI | InChI=1S/C16H13BrN2S2/c17-12-2-1-3-14(8-12)20-10-16-19-15(9-21-16)11-4-6-13(18)7-5-11/h1-9H,10,18H2 |
| InChIKey | CVHSLVLAWNKVIK-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.33 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|