C17H15BrN2S — CID 79828189
1-(3-bromophenyl)-2-(4-phenyl-1,3-thiazol-2-yl)ethanamine (PubChem CID 79828189) has the molecular formula C17H15BrN2S and a molecular weight of 359.29 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2-(4-phenyl-1,3-thiazol-2-yl)ethanamine.
| Compound Name | 1-(3-bromophenyl)-2-(4-phenyl-1,3-thiazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 79828189 |
| Molecular Formula | C17H15BrN2S |
| Molecular Weight | 359.29 g/mol |
| Exact Mass | 358.01 |
| IUPAC Name | 1-(3-bromophenyl)-2-(4-phenyl-1,3-thiazol-2-yl)ethanamine |
| SMILES | NC(Cc1nc(-c2ccccc2)cs1)c1cccc(Br)c1 |
| InChI | InChI=1S/C17H15BrN2S/c18-14-8-4-7-13(9-14)15(19)10-17-20-16(11-21-17)12-5-2-1-3-6-12/h1-9,11,15H,10,19H2 |
| InChIKey | VYELHNROVAGZJL-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.29 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |