C17H18N2S2 — CID 105006670
1-(3-ethylthiophen-2-yl)-2-(4-phenyl-1,3-thiazol-2-yl)ethanamine (PubChem CID 105006670) has the molecular formula C17H18N2S2 and a molecular weight of 314.48 g/mol. Its IUPAC name is 1-(3-ethylthiophen-2-yl)-2-(4-phenyl-1,3-thiazol-2-yl)ethanamine.
| Compound Name | 1-(3-ethylthiophen-2-yl)-2-(4-phenyl-1,3-thiazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 105006670 |
| Molecular Formula | C17H18N2S2 |
| Molecular Weight | 314.48 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 1-(3-ethylthiophen-2-yl)-2-(4-phenyl-1,3-thiazol-2-yl)ethanamine |
| SMILES | CCc1ccsc1C(N)Cc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C17H18N2S2/c1-2-12-8-9-20-17(12)14(18)10-16-19-15(11-21-16)13-6-4-3-5-7-13/h3-9,11,14H,2,10,18H2,1H3 |
| InChIKey | SKFGFFAAJYPSPT-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |