C15H13BrN2S2 — CID 105164416
1-(5-bromothiophen-3-yl)-2-(4-phenyl-1,3-thiazol-2-yl)ethanamine (PubChem CID 105164416) has the molecular formula C15H13BrN2S2 and a molecular weight of 365.32 g/mol. Its IUPAC name is 1-(5-bromothiophen-3-yl)-2-(4-phenyl-1,3-thiazol-2-yl)ethanamine.
| Compound Name | 1-(5-bromothiophen-3-yl)-2-(4-phenyl-1,3-thiazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 105164416 |
| Molecular Formula | C15H13BrN2S2 |
| Molecular Weight | 365.32 g/mol |
| Exact Mass | 363.97 |
| IUPAC Name | 1-(5-bromothiophen-3-yl)-2-(4-phenyl-1,3-thiazol-2-yl)ethanamine |
| SMILES | NC(Cc1nc(-c2ccccc2)cs1)c1csc(Br)c1 |
| InChI | InChI=1S/C15H13BrN2S2/c16-14-6-11(8-19-14)12(17)7-15-18-13(9-20-15)10-4-2-1-3-5-10/h1-6,8-9,12H,7,17H2 |
| InChIKey | XQITYPFIDUTTPS-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.32 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |