C15H12BrNO2S — CID 79819695
1-(5-bromofuran-2-yl)-2-(4-phenyl-1,3-thiazol-2-yl)ethanol (PubChem CID 79819695) has the molecular formula C15H12BrNO2S and a molecular weight of 350.24 g/mol. Its IUPAC name is 1-(5-bromofuran-2-yl)-2-(4-phenyl-1,3-thiazol-2-yl)ethanol.
| Compound Name | 1-(5-bromofuran-2-yl)-2-(4-phenyl-1,3-thiazol-2-yl)ethanol |
|---|---|
| PubChem CID | 79819695 |
| Molecular Formula | C15H12BrNO2S |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 348.98 |
| IUPAC Name | 1-(5-bromofuran-2-yl)-2-(4-phenyl-1,3-thiazol-2-yl)ethanol |
| SMILES | OC(Cc1nc(-c2ccccc2)cs1)c1ccc(Br)o1 |
| InChI | InChI=1S/C15H12BrNO2S/c16-14-7-6-13(19-14)12(18)8-15-17-11(9-20-15)10-4-2-1-3-5-10/h1-7,9,12,18H,8H2 |
| InChIKey | WYWFPGCSBRYXHS-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |