C15H15N3OS2 — CID 105110978
1-(4-ethylthiadiazol-5-yl)-2-(4-phenyl-1,3-thiazol-2-yl)ethanol (PubChem CID 105110978) has the molecular formula C15H15N3OS2 and a molecular weight of 317.44 g/mol. Its IUPAC name is 1-(4-ethylthiadiazol-5-yl)-2-(4-phenyl-1,3-thiazol-2-yl)ethanol.
| Compound Name | 1-(4-ethylthiadiazol-5-yl)-2-(4-phenyl-1,3-thiazol-2-yl)ethanol |
|---|---|
| PubChem CID | 105110978 |
| Molecular Formula | C15H15N3OS2 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 1-(4-ethylthiadiazol-5-yl)-2-(4-phenyl-1,3-thiazol-2-yl)ethanol |
| SMILES | CCc1nnsc1C(O)Cc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C15H15N3OS2/c1-2-11-15(21-18-17-11)13(19)8-14-16-12(9-20-14)10-6-4-3-5-7-10/h3-7,9,13,19H,2,8H2,1H3 |
| InChIKey | JNFWSCVEKFTBDR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |