C8H14N4S3 — CID 155019877
[4-(diaminomethylsulfanylmethyl)thiophen-3-yl]methyl carbamimidothioate (PubChem CID 155019877) has the molecular formula C8H14N4S3 and a molecular weight of 262.43 g/mol. Its IUPAC name is [4-(diaminomethylsulfanylmethyl)thiophen-3-yl]methyl carbamimidothioate.
| Compound Name | [4-(diaminomethylsulfanylmethyl)thiophen-3-yl]methyl carbamimidothioate |
|---|---|
| PubChem CID | 155019877 |
| Molecular Formula | C8H14N4S3 |
| Molecular Weight | 262.43 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | [4-(diaminomethylsulfanylmethyl)thiophen-3-yl]methyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCc1cscc1CSC(N)N |
| InChI | InChI=1S/C8H14N4S3/c9-7(10)14-3-5-1-13-2-6(5)4-15-8(11)12/h1-2,7H,3-4,9-10H2,(H3,11,12) |
| InChIKey | JEWWOPGNHZHBGB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.43 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|