C10H12Cl2N4S2 — CID 142560644
[2-(carbamimidoylsulfanylmethyl)-4,5-dichlorophenyl]methyl carbamimidothioate (PubChem CID 142560644) has the molecular formula C10H12Cl2N4S2 and a molecular weight of 323.27 g/mol. Its IUPAC name is [2-(carbamimidoylsulfanylmethyl)-4,5-dichlorophenyl]methyl carbamimidothioate.
| Compound Name | [2-(carbamimidoylsulfanylmethyl)-4,5-dichlorophenyl]methyl carbamimidothioate |
|---|---|
| PubChem CID | 142560644 |
| Molecular Formula | C10H12Cl2N4S2 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | [2-(carbamimidoylsulfanylmethyl)-4,5-dichlorophenyl]methyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCc1cc(Cl)c(Cl)cc1CS/C(N)=N/[H] |
| InChI | InChI=1S/C10H12Cl2N4S2/c11-7-1-5(3-17-9(13)14)6(2-8(7)12)4-18-10(15)16/h1-2H,3-4H2,(H3,13,14)(H3,15,16) |
| InChIKey | CJZSVMHZXDOJAQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|