C16H16Cl2N4S3 — CID 173106885
[2-[2-[(carbamothioylamino)methyl]-4-chlorophenyl]sulfanyl-5-chlorophenyl]methyl carbamimidothioate (PubChem CID 173106885) has the molecular formula C16H16Cl2N4S3 and a molecular weight of 431.44 g/mol. Its IUPAC name is [2-[2-[(carbamothioylamino)methyl]-4-chlorophenyl]sulfanyl-5-chlorophenyl]methyl carbamimidothioate.
| Compound Name | [2-[2-[(carbamothioylamino)methyl]-4-chlorophenyl]sulfanyl-5-chlorophenyl]methyl carbamimidothioate |
|---|---|
| PubChem CID | 173106885 |
| Molecular Formula | C16H16Cl2N4S3 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 429.99 |
| IUPAC Name | [2-[2-[(carbamothioylamino)methyl]-4-chlorophenyl]sulfanyl-5-chlorophenyl]methyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCc1cc(Cl)ccc1Sc1ccc(Cl)cc1CNC(N)=S |
| InChI | InChI=1S/C16H16Cl2N4S3/c17-11-1-3-13(9(5-11)7-22-16(21)23)25-14-4-2-12(18)6-10(14)8-24-15(19)20/h1-6H,7-8H2,(H3,19,20)(H3,21,22,23) |
| InChIKey | RBZWTNXRGHUPAH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 87.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|