C16H19N5S3 — CID 25069583
[2-[4-amino-2-(carbamimidoylsulfanylmethyl)phenyl]sulfanylphenyl]methyl carbamimidothioate (PubChem CID 25069583) has the molecular formula C16H19N5S3 and a molecular weight of 377.56 g/mol. Its IUPAC name is [2-[4-amino-2-(carbamimidoylsulfanylmethyl)phenyl]sulfanylphenyl]methyl carbamimidothioate.
| Compound Name | [2-[4-amino-2-(carbamimidoylsulfanylmethyl)phenyl]sulfanylphenyl]methyl carbamimidothioate |
|---|---|
| PubChem CID | 25069583 |
| Molecular Formula | C16H19N5S3 |
| Molecular Weight | 377.56 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | [2-[4-amino-2-(carbamimidoylsulfanylmethyl)phenyl]sulfanylphenyl]methyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCc1ccccc1Sc1ccc(N)cc1CS/C(N)=N/[H] |
| InChI | InChI=1S/C16H19N5S3/c17-12-5-6-14(11(7-12)9-23-16(20)21)24-13-4-2-1-3-10(13)8-22-15(18)19/h1-7H,8-9,17H2,(H3,18,19)(H3,20,21) |
| InChIKey | QHFIEZHJPCSFSO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 125.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.56 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|