C15H14ClFN2OS2 — CID 145480261
[5-chloro-2-[4-fluoro-2-(sulfanylmethyl)phenoxy]phenyl]methyl carbamimidothioate (PubChem CID 145480261) has the molecular formula C15H14ClFN2OS2 and a molecular weight of 356.88 g/mol. Its IUPAC name is [5-chloro-2-[4-fluoro-2-(sulfanylmethyl)phenoxy]phenyl]methyl carbamimidothioate.
| Compound Name | [5-chloro-2-[4-fluoro-2-(sulfanylmethyl)phenoxy]phenyl]methyl carbamimidothioate |
|---|---|
| PubChem CID | 145480261 |
| Molecular Formula | C15H14ClFN2OS2 |
| Molecular Weight | 356.88 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | [5-chloro-2-[4-fluoro-2-(sulfanylmethyl)phenoxy]phenyl]methyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCc1cc(Cl)ccc1Oc1ccc(F)cc1CS |
| InChI | InChI=1S/C15H14ClFN2OS2/c16-11-1-3-14(10(5-11)8-22-15(18)19)20-13-4-2-12(17)6-9(13)7-21/h1-6,21H,7-8H2,(H3,18,19) |
| InChIKey | GVZRFMZZISKEJB-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.88 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|