C12H13BrN2S2 — CID 82840747
3-bromo-4-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]aniline (PubChem CID 82840747) has the molecular formula C12H13BrN2S2 and a molecular weight of 329.29 g/mol. Its IUPAC name is 3-bromo-4-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]aniline.
| Compound Name | 3-bromo-4-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]aniline |
|---|---|
| PubChem CID | 82840747 |
| Molecular Formula | C12H13BrN2S2 |
| Molecular Weight | 329.29 g/mol |
| Exact Mass | 327.97 |
| IUPAC Name | 3-bromo-4-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]aniline |
| SMILES | CCc1nc(CSc2ccc(N)cc2Br)cs1 |
| InChI | InChI=1S/C12H13BrN2S2/c1-2-12-15-9(7-17-12)6-16-11-4-3-8(14)5-10(11)13/h3-5,7H,2,6,14H2,1H3 |
| InChIKey | CNQAUNNIYAHJKL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.29 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|