C13H15ClN2S2 — CID 43250856
5-chloro-2-[(2-propyl-1,3-thiazol-4-yl)methylsulfanyl]aniline (PubChem CID 43250856) has the molecular formula C13H15ClN2S2 and a molecular weight of 298.86 g/mol. Its IUPAC name is 5-chloro-2-[(2-propyl-1,3-thiazol-4-yl)methylsulfanyl]aniline.
| Compound Name | 5-chloro-2-[(2-propyl-1,3-thiazol-4-yl)methylsulfanyl]aniline |
|---|---|
| PubChem CID | 43250856 |
| Molecular Formula | C13H15ClN2S2 |
| Molecular Weight | 298.86 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 5-chloro-2-[(2-propyl-1,3-thiazol-4-yl)methylsulfanyl]aniline |
| SMILES | CCCc1nc(CSc2ccc(Cl)cc2N)cs1 |
| InChI | InChI=1S/C13H15ClN2S2/c1-2-3-13-16-10(8-18-13)7-17-12-5-4-9(14)6-11(12)15/h4-6,8H,2-3,7,15H2,1H3 |
| InChIKey | UEYSNSPOAVHALL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.86 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|