C11H19NO3S2 — CID 111104868
5-[(2-ethyl-1,3-thiazol-4-yl)methylsulfonyl]pentan-1-ol (PubChem CID 111104868) has the molecular formula C11H19NO3S2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 5-[(2-ethyl-1,3-thiazol-4-yl)methylsulfonyl]pentan-1-ol.
| Compound Name | 5-[(2-ethyl-1,3-thiazol-4-yl)methylsulfonyl]pentan-1-ol |
|---|---|
| PubChem CID | 111104868 |
| Molecular Formula | C11H19NO3S2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 5-[(2-ethyl-1,3-thiazol-4-yl)methylsulfonyl]pentan-1-ol |
| SMILES | CCc1nc(CS(=O)(=O)CCCCCO)cs1 |
| InChI | InChI=1S/C11H19NO3S2/c1-2-11-12-10(8-16-11)9-17(14,15)7-5-3-4-6-13/h8,13H,2-7,9H2,1H3 |
| InChIKey | HKKHFNYZERIRJU-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|