About 5-[(2-ethyl-1,3-thiazol-4-yl)methylsulfonyl]pentan-1-ol
5-[(2-ethyl-1,3-thiazol-4-yl)methylsulfonyl]pentan-1-ol (PubChem CID 111104868) has the molecular formula C11H19NO3S2
and a molecular weight of 277.41 g/mol. Its IUPAC name is 5-[(2-ethyl-1,3-thiazol-4-yl)methylsulfonyl]pentan-1-ol.
Molecular Properties
| Compound Name | 5-[(2-ethyl-1,3-thiazol-4-yl)methylsulfonyl]pentan-1-ol |
| PubChem CID | 111104868 |
| Molecular Formula | C11H19NO3S2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 5-[(2-ethyl-1,3-thiazol-4-yl)methylsulfonyl]pentan-1-ol |
| SMILES | CCc1nc(CS(=O)(=O)CCCCCO)cs1 |
| InChI | InChI=1S/C11H19NO3S2/c1-2-11-12-10(8-16-11)9-17(14,15)7-5-3-4-6-13/h8,13H,2-7,9H2,1H3 |
| InChIKey | HKKHFNYZERIRJU-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2-ethyl-1,3-thiazol-4-yl)methylsulfonyl]pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2-ethyl-1,3-thiazol-4-yl)methylsulfonyl]pentan-1-ol?
The IUPAC name of 5-[(2-ethyl-1,3-thiazol-4-yl)methylsulfonyl]pentan-1-ol (CID 111104868) is 5-[(2-ethyl-1,3-thiazol-4-yl)methylsulfonyl]pentan-1-ol.
What is the SMILES notation for 5-[(2-ethyl-1,3-thiazol-4-yl)methylsulfonyl]pentan-1-ol?
The canonical SMILES for 5-[(2-ethyl-1,3-thiazol-4-yl)methylsulfonyl]pentan-1-ol is CCc1nc(CS(=O)(=O)CCCCCO)cs1.
What is the InChIKey of 5-[(2-ethyl-1,3-thiazol-4-yl)methylsulfonyl]pentan-1-ol?
The InChIKey is HKKHFNYZERIRJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO3S2/c1-2-11-12-10(8-16-11)9-17(14,15)7-5-3-4-6-13/h8,13H,2-7,9H2,1H3.
What are the key properties of 5-[(2-ethyl-1,3-thiazol-4-yl)methylsulfonyl]pentan-1-ol?
5-[(2-ethyl-1,3-thiazol-4-yl)methylsulfonyl]pentan-1-ol has a molecular weight of 277.41 g/mol, XLogP of 1.78, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-ethyl-1,3-thiazol-4-yl)methylsulfonyl]pentan-1-ol is sourced from PubChem (CID 111104868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).