C14H16N2O3S2 — CID 56816685
3-[(2-benzyl-1,3-thiazol-4-yl)methylsulfonyl]propanamide (PubChem CID 56816685) has the molecular formula C14H16N2O3S2 and a molecular weight of 324.43 g/mol. Its IUPAC name is 3-[(2-benzyl-1,3-thiazol-4-yl)methylsulfonyl]propanamide.
| Compound Name | 3-[(2-benzyl-1,3-thiazol-4-yl)methylsulfonyl]propanamide |
|---|---|
| PubChem CID | 56816685 |
| Molecular Formula | C14H16N2O3S2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 3-[(2-benzyl-1,3-thiazol-4-yl)methylsulfonyl]propanamide |
| SMILES | NC(=O)CCS(=O)(=O)Cc1csc(Cc2ccccc2)n1 |
| InChI | InChI=1S/C14H16N2O3S2/c15-13(17)6-7-21(18,19)10-12-9-20-14(16-12)8-11-4-2-1-3-5-11/h1-5,9H,6-8,10H2,(H2,15,17) |
| InChIKey | IUKMVGOHTAWMPK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |