C11H11NS2 — CID 39099745
(2-benzyl-1,3-thiazol-4-yl)methanethiol (PubChem CID 39099745) has the molecular formula C11H11NS2 and a molecular weight of 221.35 g/mol. Its IUPAC name is (2-benzyl-1,3-thiazol-4-yl)methanethiol.
| Compound Name | (2-benzyl-1,3-thiazol-4-yl)methanethiol |
|---|---|
| PubChem CID | 39099745 |
| Molecular Formula | C11H11NS2 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | (2-benzyl-1,3-thiazol-4-yl)methanethiol |
| SMILES | SCc1csc(Cc2ccccc2)n1 |
| InChI | InChI=1S/C11H11NS2/c13-7-10-8-14-11(12-10)6-9-4-2-1-3-5-9/h1-5,8,13H,6-7H2 |
| InChIKey | IDJMQZPYTNBTJS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|