C19H19NOS2 — CID 71935057
2-benzyl-4-[(3-methylphenyl)methylsulfinylmethyl]-1,3-thiazole (PubChem CID 71935057) has the molecular formula C19H19NOS2 and a molecular weight of 341.50 g/mol. Its IUPAC name is 2-benzyl-4-[(3-methylphenyl)methylsulfinylmethyl]-1,3-thiazole.
| Compound Name | 2-benzyl-4-[(3-methylphenyl)methylsulfinylmethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 71935057 |
| Molecular Formula | C19H19NOS2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 2-benzyl-4-[(3-methylphenyl)methylsulfinylmethyl]-1,3-thiazole |
| SMILES | Cc1cccc(CS(=O)Cc2csc(Cc3ccccc3)n2)c1 |
| InChI | InChI=1S/C19H19NOS2/c1-15-6-5-9-17(10-15)13-23(21)14-18-12-22-19(20-18)11-16-7-3-2-4-8-16/h2-10,12H,11,13-14H2,1H3 |
| InChIKey | JJNRMMJZKXPIQB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |