About 5-[(2-ethyl-1,3-thiazol-4-yl)methylamino]-4,4-dimethylpentan-1-ol
5-[(2-ethyl-1,3-thiazol-4-yl)methylamino]-4,4-dimethylpentan-1-ol (PubChem CID 103897555) has the molecular formula C13H24N2OS
and a molecular weight of 256.41 g/mol. Its IUPAC name is 5-[(2-ethyl-1,3-thiazol-4-yl)methylamino]-4,4-dimethylpentan-1-ol.
Molecular Properties
| Compound Name | 5-[(2-ethyl-1,3-thiazol-4-yl)methylamino]-4,4-dimethylpentan-1-ol |
| PubChem CID | 103897555 |
| Molecular Formula | C13H24N2OS |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 5-[(2-ethyl-1,3-thiazol-4-yl)methylamino]-4,4-dimethylpentan-1-ol |
| SMILES | CCc1nc(CNCC(C)(C)CCCO)cs1 |
| InChI | InChI=1S/C13H24N2OS/c1-4-12-15-11(9-17-12)8-14-10-13(2,3)6-5-7-16/h9,14,16H,4-8,10H2,1-3H3 |
| InChIKey | PUOMZRSWIMWUPX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(2-ethyl-1,3-thiazol-4-yl)methylamino]-4,4-dimethylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2-ethyl-1,3-thiazol-4-yl)methylamino]-4,4-dimethylpentan-1-ol?
The IUPAC name of 5-[(2-ethyl-1,3-thiazol-4-yl)methylamino]-4,4-dimethylpentan-1-ol (CID 103897555) is 5-[(2-ethyl-1,3-thiazol-4-yl)methylamino]-4,4-dimethylpentan-1-ol.
What is the SMILES notation for 5-[(2-ethyl-1,3-thiazol-4-yl)methylamino]-4,4-dimethylpentan-1-ol?
The canonical SMILES for 5-[(2-ethyl-1,3-thiazol-4-yl)methylamino]-4,4-dimethylpentan-1-ol is CCc1nc(CNCC(C)(C)CCCO)cs1.
What is the InChIKey of 5-[(2-ethyl-1,3-thiazol-4-yl)methylamino]-4,4-dimethylpentan-1-ol?
The InChIKey is PUOMZRSWIMWUPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2OS/c1-4-12-15-11(9-17-12)8-14-10-13(2,3)6-5-7-16/h9,14,16H,4-8,10H2,1-3H3.
What are the key properties of 5-[(2-ethyl-1,3-thiazol-4-yl)methylamino]-4,4-dimethylpentan-1-ol?
5-[(2-ethyl-1,3-thiazol-4-yl)methylamino]-4,4-dimethylpentan-1-ol has a molecular weight of 256.41 g/mol, XLogP of 2.59, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-ethyl-1,3-thiazol-4-yl)methylamino]-4,4-dimethylpentan-1-ol is sourced from PubChem (CID 103897555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).