C16H23N3O — CID 106144835
4,4-dimethyl-5-(quinoxalin-2-ylmethylamino)pentan-1-ol (PubChem CID 106144835) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is 4,4-dimethyl-5-(quinoxalin-2-ylmethylamino)pentan-1-ol.
| Compound Name | 4,4-dimethyl-5-(quinoxalin-2-ylmethylamino)pentan-1-ol |
|---|---|
| PubChem CID | 106144835 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 4,4-dimethyl-5-(quinoxalin-2-ylmethylamino)pentan-1-ol |
| SMILES | CC(C)(CCCO)CNCc1cnc2ccccc2n1 |
| InChI | InChI=1S/C16H23N3O/c1-16(2,8-5-9-20)12-17-10-13-11-18-14-6-3-4-7-15(14)19-13/h3-4,6-7,11,17,20H,5,8-10,12H2,1-2H3 |
| InChIKey | HREOCTHSLUICMB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |