C12H11F4N3 — CID 106290130
2,2,3,3-tetrafluoro-N-(quinoxalin-2-ylmethyl)propan-1-amine (PubChem CID 106290130) has the molecular formula C12H11F4N3 and a molecular weight of 273.23 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-(quinoxalin-2-ylmethyl)propan-1-amine.
| Compound Name | 2,2,3,3-tetrafluoro-N-(quinoxalin-2-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 106290130 |
| Molecular Formula | C12H11F4N3 |
| Molecular Weight | 273.23 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-(quinoxalin-2-ylmethyl)propan-1-amine |
| SMILES | FC(F)C(F)(F)CNCc1cnc2ccccc2n1 |
| InChI | InChI=1S/C12H11F4N3/c13-11(14)12(15,16)7-17-5-8-6-18-9-3-1-2-4-10(9)19-8/h1-4,6,11,17H,5,7H2 |
| InChIKey | GRHQQUHOSLSFKK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.23 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|