C11H21ClN2OS2 — CID 115616096
3-[2-[(2-ethyl-1,3-thiazol-4-yl)methylamino]ethylsulfanyl]propan-1-ol;hydrochloride (PubChem CID 115616096) has the molecular formula C11H21ClN2OS2 and a molecular weight of 296.89 g/mol. Its IUPAC name is 3-[2-[(2-ethyl-1,3-thiazol-4-yl)methylamino]ethylsulfanyl]propan-1-ol;hydrochloride.
| Compound Name | 3-[2-[(2-ethyl-1,3-thiazol-4-yl)methylamino]ethylsulfanyl]propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 115616096 |
| Molecular Formula | C11H21ClN2OS2 |
| Molecular Weight | 296.89 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 3-[2-[(2-ethyl-1,3-thiazol-4-yl)methylamino]ethylsulfanyl]propan-1-ol;hydrochloride |
| SMILES | CCc1nc(CNCCSCCCO)cs1.Cl |
| InChI | InChI=1S/C11H20N2OS2.ClH/c1-2-11-13-10(9-16-11)8-12-4-7-15-6-3-5-14;/h9,12,14H,2-8H2,1H3;1H |
| InChIKey | HRQCNSCQFDHIAO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.89 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|