About 6-[(2-ethyl-1,3-thiazol-4-yl)methylamino]hexan-3-ol
6-[(2-ethyl-1,3-thiazol-4-yl)methylamino]hexan-3-ol (PubChem CID 115654661) has the molecular formula C12H22N2OS
and a molecular weight of 242.39 g/mol. Its IUPAC name is 6-[(2-ethyl-1,3-thiazol-4-yl)methylamino]hexan-3-ol.
Molecular Properties
| Compound Name | 6-[(2-ethyl-1,3-thiazol-4-yl)methylamino]hexan-3-ol |
| PubChem CID | 115654661 |
| Molecular Formula | C12H22N2OS |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 6-[(2-ethyl-1,3-thiazol-4-yl)methylamino]hexan-3-ol |
| SMILES | CCc1nc(CNCCCC(O)CC)cs1 |
| InChI | InChI=1S/C12H22N2OS/c1-3-11(15)6-5-7-13-8-10-9-16-12(4-2)14-10/h9,11,13,15H,3-8H2,1-2H3 |
| InChIKey | GYACWAQRIFAPKQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[(2-ethyl-1,3-thiazol-4-yl)methylamino]hexan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2-ethyl-1,3-thiazol-4-yl)methylamino]hexan-3-ol?
The IUPAC name of 6-[(2-ethyl-1,3-thiazol-4-yl)methylamino]hexan-3-ol (CID 115654661) is 6-[(2-ethyl-1,3-thiazol-4-yl)methylamino]hexan-3-ol.
What is the SMILES notation for 6-[(2-ethyl-1,3-thiazol-4-yl)methylamino]hexan-3-ol?
The canonical SMILES for 6-[(2-ethyl-1,3-thiazol-4-yl)methylamino]hexan-3-ol is CCc1nc(CNCCCC(O)CC)cs1.
What is the InChIKey of 6-[(2-ethyl-1,3-thiazol-4-yl)methylamino]hexan-3-ol?
The InChIKey is GYACWAQRIFAPKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2OS/c1-3-11(15)6-5-7-13-8-10-9-16-12(4-2)14-10/h9,11,13,15H,3-8H2,1-2H3.
What are the key properties of 6-[(2-ethyl-1,3-thiazol-4-yl)methylamino]hexan-3-ol?
6-[(2-ethyl-1,3-thiazol-4-yl)methylamino]hexan-3-ol has a molecular weight of 242.39 g/mol, XLogP of 2.35, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2-ethyl-1,3-thiazol-4-yl)methylamino]hexan-3-ol is sourced from PubChem (CID 115654661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).