C9H15NOS — CID 63201551
1-(4-ethyl-1,3-thiazol-2-yl)butan-2-ol (PubChem CID 63201551) has the molecular formula C9H15NOS and a molecular weight of 185.29 g/mol. Its IUPAC name is 1-(4-ethyl-1,3-thiazol-2-yl)butan-2-ol.
| Compound Name | 1-(4-ethyl-1,3-thiazol-2-yl)butan-2-ol |
|---|---|
| PubChem CID | 63201551 |
| Molecular Formula | C9H15NOS |
| Molecular Weight | 185.29 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | 1-(4-ethyl-1,3-thiazol-2-yl)butan-2-ol |
| SMILES | CCc1csc(CC(O)CC)n1 |
| InChI | InChI=1S/C9H15NOS/c1-3-7-6-12-9(10-7)5-8(11)4-2/h6,8,11H,3-5H2,1-2H3 |
| InChIKey | XULHFRRYBOCMJH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |