C10H16ClNS — CID 63203067
2-(2-chloropentyl)-4-ethyl-1,3-thiazole (PubChem CID 63203067) has the molecular formula C10H16ClNS and a molecular weight of 217.76 g/mol. Its IUPAC name is 2-(2-chloropentyl)-4-ethyl-1,3-thiazole.
| Compound Name | 2-(2-chloropentyl)-4-ethyl-1,3-thiazole |
|---|---|
| PubChem CID | 63203067 |
| Molecular Formula | C10H16ClNS |
| Molecular Weight | 217.76 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 2-(2-chloropentyl)-4-ethyl-1,3-thiazole |
| SMILES | CCCC(Cl)Cc1nc(CC)cs1 |
| InChI | InChI=1S/C10H16ClNS/c1-3-5-8(11)6-10-12-9(4-2)7-13-10/h7-8H,3-6H2,1-2H3 |
| InChIKey | STWXXMSSVUPWEJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.76 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|