C9H15NS2 — CID 122463121
4-ethyl-2-(2-ethylsulfanylethyl)-1,3-thiazole (PubChem CID 122463121) has the molecular formula C9H15NS2 and a molecular weight of 201.36 g/mol. Its IUPAC name is 4-ethyl-2-(2-ethylsulfanylethyl)-1,3-thiazole.
| Compound Name | 4-ethyl-2-(2-ethylsulfanylethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 122463121 |
| Molecular Formula | C9H15NS2 |
| Molecular Weight | 201.36 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 4-ethyl-2-(2-ethylsulfanylethyl)-1,3-thiazole |
| SMILES | CCSCCc1nc(CC)cs1 |
| InChI | InChI=1S/C9H15NS2/c1-3-8-7-12-9(10-8)5-6-11-4-2/h7H,3-6H2,1-2H3 |
| InChIKey | IBTYOESBYDOKGJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|