C12H23N3S — CID 60727171
N',N'-diethyl-N-[(2-ethyl-1,3-thiazol-4-yl)methyl]ethane-1,2-diamine (PubChem CID 60727171) has the molecular formula C12H23N3S and a molecular weight of 241.40 g/mol. Its IUPAC name is N',N'-diethyl-N-[(2-ethyl-1,3-thiazol-4-yl)methyl]ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-[(2-ethyl-1,3-thiazol-4-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 60727171 |
| Molecular Formula | C12H23N3S |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | N',N'-diethyl-N-[(2-ethyl-1,3-thiazol-4-yl)methyl]ethane-1,2-diamine |
| SMILES | CCc1nc(CNCCN(CC)CC)cs1 |
| InChI | InChI=1S/C12H23N3S/c1-4-12-14-11(10-16-12)9-13-7-8-15(5-2)6-3/h10,13H,4-9H2,1-3H3 |
| InChIKey | ZRLDEJXCJRKPGN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|