C12H12FNO2S2 — CID 64717531
2-ethyl-4-[(4-fluorophenyl)sulfonylmethyl]-1,3-thiazole (PubChem CID 64717531) has the molecular formula C12H12FNO2S2 and a molecular weight of 285.37 g/mol. Its IUPAC name is 2-ethyl-4-[(4-fluorophenyl)sulfonylmethyl]-1,3-thiazole.
| Compound Name | 2-ethyl-4-[(4-fluorophenyl)sulfonylmethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 64717531 |
| Molecular Formula | C12H12FNO2S2 |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | 2-ethyl-4-[(4-fluorophenyl)sulfonylmethyl]-1,3-thiazole |
| SMILES | CCc1nc(CS(=O)(=O)c2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C12H12FNO2S2/c1-2-12-14-10(7-17-12)8-18(15,16)11-5-3-9(13)4-6-11/h3-7H,2,8H2,1H3 |
| InChIKey | UDCRSJSTEVYVMW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |