C13H15NO3S2 — CID 47822854
4-[(4-ethoxyphenyl)sulfonylmethyl]-2-methyl-1,3-thiazole (PubChem CID 47822854) has the molecular formula C13H15NO3S2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 4-[(4-ethoxyphenyl)sulfonylmethyl]-2-methyl-1,3-thiazole.
| Compound Name | 4-[(4-ethoxyphenyl)sulfonylmethyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 47822854 |
| Molecular Formula | C13H15NO3S2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 4-[(4-ethoxyphenyl)sulfonylmethyl]-2-methyl-1,3-thiazole |
| SMILES | CCOc1ccc(S(=O)(=O)Cc2csc(C)n2)cc1 |
| InChI | InChI=1S/C13H15NO3S2/c1-3-17-12-4-6-13(7-5-12)19(15,16)9-11-8-18-10(2)14-11/h4-8H,3,9H2,1-2H3 |
| InChIKey | DMDNIOGJKRQSQN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |