C14H16N2O4S2 — CID 47044569
ethyl 4-[(2-methyl-1,3-thiazol-4-yl)methylsulfamoyl]benzoate (PubChem CID 47044569) has the molecular formula C14H16N2O4S2 and a molecular weight of 340.43 g/mol. Its IUPAC name is ethyl 4-[(2-methyl-1,3-thiazol-4-yl)methylsulfamoyl]benzoate.
| Compound Name | ethyl 4-[(2-methyl-1,3-thiazol-4-yl)methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 47044569 |
| Molecular Formula | C14H16N2O4S2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | ethyl 4-[(2-methyl-1,3-thiazol-4-yl)methylsulfamoyl]benzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)NCc2csc(C)n2)cc1 |
| InChI | InChI=1S/C14H16N2O4S2/c1-3-20-14(17)11-4-6-13(7-5-11)22(18,19)15-8-12-9-21-10(2)16-12/h4-7,9,15H,3,8H2,1-2H3 |
| InChIKey | QGYFSGGBRIXHOA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |