C12H15N3O3S2 — CID 110718117
N-[(2-amino-1,3-thiazol-4-yl)methyl]-4-ethoxybenzenesulfonamide (PubChem CID 110718117) has the molecular formula C12H15N3O3S2 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-[(2-amino-1,3-thiazol-4-yl)methyl]-4-ethoxybenzenesulfonamide.
| Compound Name | N-[(2-amino-1,3-thiazol-4-yl)methyl]-4-ethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 110718117 |
| Molecular Formula | C12H15N3O3S2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | N-[(2-amino-1,3-thiazol-4-yl)methyl]-4-ethoxybenzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NCc2csc(N)n2)cc1 |
| InChI | InChI=1S/C12H15N3O3S2/c1-2-18-10-3-5-11(6-4-10)20(16,17)14-7-9-8-19-12(13)15-9/h3-6,8,14H,2,7H2,1H3,(H2,13,15) |
| InChIKey | WAOWVFGTKXJAAW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |