C14H17N3O3S — CID 122263634
4-ethoxy-N-[(6-methylpyrimidin-4-yl)methyl]benzenesulfonamide (PubChem CID 122263634) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is 4-ethoxy-N-[(6-methylpyrimidin-4-yl)methyl]benzenesulfonamide.
| Compound Name | 4-ethoxy-N-[(6-methylpyrimidin-4-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122263634 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 4-ethoxy-N-[(6-methylpyrimidin-4-yl)methyl]benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NCc2cc(C)ncn2)cc1 |
| InChI | InChI=1S/C14H17N3O3S/c1-3-20-13-4-6-14(7-5-13)21(18,19)17-9-12-8-11(2)15-10-16-12/h4-8,10,17H,3,9H2,1-2H3 |
| InChIKey | PRTMJISTXBFUHP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |