C12H13ClN2O3S2 — CID 108783775
N-[4-(chloromethyl)-1,3-thiazol-2-yl]-4-ethoxybenzenesulfonamide (PubChem CID 108783775) has the molecular formula C12H13ClN2O3S2 and a molecular weight of 332.83 g/mol. Its IUPAC name is N-[4-(chloromethyl)-1,3-thiazol-2-yl]-4-ethoxybenzenesulfonamide.
| Compound Name | N-[4-(chloromethyl)-1,3-thiazol-2-yl]-4-ethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 108783775 |
| Molecular Formula | C12H13ClN2O3S2 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | N-[4-(chloromethyl)-1,3-thiazol-2-yl]-4-ethoxybenzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2nc(CCl)cs2)cc1 |
| InChI | InChI=1S/C12H13ClN2O3S2/c1-2-18-10-3-5-11(6-4-10)20(16,17)15-12-14-9(7-13)8-19-12/h3-6,8H,2,7H2,1H3,(H,14,15) |
| InChIKey | HAZLOVHYSINDHP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|