C11H12ClN3O3S2 — CID 123219813
N'-(4-chloro-1,3-thiazol-2-yl)-4-ethoxybenzenesulfonohydrazide (PubChem CID 123219813) has the molecular formula C11H12ClN3O3S2 and a molecular weight of 333.82 g/mol. Its IUPAC name is N'-(4-chloro-1,3-thiazol-2-yl)-4-ethoxybenzenesulfonohydrazide.
| Compound Name | N'-(4-chloro-1,3-thiazol-2-yl)-4-ethoxybenzenesulfonohydrazide |
|---|---|
| PubChem CID | 123219813 |
| Molecular Formula | C11H12ClN3O3S2 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | N'-(4-chloro-1,3-thiazol-2-yl)-4-ethoxybenzenesulfonohydrazide |
| SMILES | CCOc1ccc(S(=O)(=O)NNc2nc(Cl)cs2)cc1 |
| InChI | InChI=1S/C11H12ClN3O3S2/c1-2-18-8-3-5-9(6-4-8)20(16,17)15-14-11-13-10(12)7-19-11/h3-7,15H,2H2,1H3,(H,13,14) |
| InChIKey | NZVQFFVRDNHAAG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazole_amine_G(2)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|