C16H15N3O4S3 — CID 9083645
N'-(4-ethoxyphenyl)sulfonyl-2-thiophen-3-yl-1,3-thiazole-4-carbohydrazide (PubChem CID 9083645) has the molecular formula C16H15N3O4S3 and a molecular weight of 409.51 g/mol. Its IUPAC name is N'-(4-ethoxyphenyl)sulfonyl-2-thiophen-3-yl-1,3-thiazole-4-carbohydrazide.
| Compound Name | N'-(4-ethoxyphenyl)sulfonyl-2-thiophen-3-yl-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 9083645 |
| Molecular Formula | C16H15N3O4S3 |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.02 |
| IUPAC Name | N'-(4-ethoxyphenyl)sulfonyl-2-thiophen-3-yl-1,3-thiazole-4-carbohydrazide |
| SMILES | CCOc1ccc(S(=O)(=O)NNC(=O)c2csc(-c3ccsc3)n2)cc1 |
| InChI | InChI=1S/C16H15N3O4S3/c1-2-23-12-3-5-13(6-4-12)26(21,22)19-18-15(20)14-10-25-16(17-14)11-7-8-24-9-11/h3-10,19H,2H2,1H3,(H,18,20) |
| InChIKey | AQIMQJPLWVXLDF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|