C17H15NO3S2 — CID 155594299
thiophen-3-ylmethyl 2-(4-ethoxyphenyl)-1,3-thiazole-4-carboxylate (PubChem CID 155594299) has the molecular formula C17H15NO3S2 and a molecular weight of 345.45 g/mol. Its IUPAC name is thiophen-3-ylmethyl 2-(4-ethoxyphenyl)-1,3-thiazole-4-carboxylate.
| Compound Name | thiophen-3-ylmethyl 2-(4-ethoxyphenyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 155594299 |
| Molecular Formula | C17H15NO3S2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | thiophen-3-ylmethyl 2-(4-ethoxyphenyl)-1,3-thiazole-4-carboxylate |
| SMILES | CCOc1ccc(-c2nc(C(=O)OCc3ccsc3)cs2)cc1 |
| InChI | InChI=1S/C17H15NO3S2/c1-2-20-14-5-3-13(4-6-14)16-18-15(11-23-16)17(19)21-9-12-7-8-22-10-12/h3-8,10-11H,2,9H2,1H3 |
| InChIKey | FSKDXFLFFDDMJL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |