C18H17NO3S2 — CID 165153483
2-thiophen-2-ylethyl 2-(4-ethoxyphenyl)-1,3-thiazole-4-carboxylate (PubChem CID 165153483) has the molecular formula C18H17NO3S2 and a molecular weight of 359.47 g/mol. Its IUPAC name is 2-thiophen-2-ylethyl 2-(4-ethoxyphenyl)-1,3-thiazole-4-carboxylate.
| Compound Name | 2-thiophen-2-ylethyl 2-(4-ethoxyphenyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 165153483 |
| Molecular Formula | C18H17NO3S2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 2-thiophen-2-ylethyl 2-(4-ethoxyphenyl)-1,3-thiazole-4-carboxylate |
| SMILES | CCOc1ccc(-c2nc(C(=O)OCCc3cccs3)cs2)cc1 |
| InChI | InChI=1S/C18H17NO3S2/c1-2-21-14-7-5-13(6-8-14)17-19-16(12-24-17)18(20)22-10-9-15-4-3-11-23-15/h3-8,11-12H,2,9-10H2,1H3 |
| InChIKey | LQSQPUVXVTWSLS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |