C18H23NO3S — CID 155594268
ethyl 2-(4-hexoxyphenyl)-1,3-thiazole-4-carboxylate (PubChem CID 155594268) has the molecular formula C18H23NO3S and a molecular weight of 333.45 g/mol. Its IUPAC name is ethyl 2-(4-hexoxyphenyl)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-(4-hexoxyphenyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 155594268 |
| Molecular Formula | C18H23NO3S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | ethyl 2-(4-hexoxyphenyl)-1,3-thiazole-4-carboxylate |
| SMILES | CCCCCCOc1ccc(-c2nc(C(=O)OCC)cs2)cc1 |
| InChI | InChI=1S/C18H23NO3S/c1-3-5-6-7-12-22-15-10-8-14(9-11-15)17-19-16(13-23-17)18(20)21-4-2/h8-11,13H,3-7,12H2,1-2H3 |
| InChIKey | VCADLNXNCKCMLU-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|