C19H18N2O3S — CID 166205252
pyridin-3-ylmethyl 2-(4-propoxyphenyl)-1,3-thiazole-4-carboxylate (PubChem CID 166205252) has the molecular formula C19H18N2O3S and a molecular weight of 354.43 g/mol. Its IUPAC name is pyridin-3-ylmethyl 2-(4-propoxyphenyl)-1,3-thiazole-4-carboxylate.
| Compound Name | pyridin-3-ylmethyl 2-(4-propoxyphenyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 166205252 |
| Molecular Formula | C19H18N2O3S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | pyridin-3-ylmethyl 2-(4-propoxyphenyl)-1,3-thiazole-4-carboxylate |
| SMILES | CCCOc1ccc(-c2nc(C(=O)OCc3cccnc3)cs2)cc1 |
| InChI | InChI=1S/C19H18N2O3S/c1-2-10-23-16-7-5-15(6-8-16)18-21-17(13-25-18)19(22)24-12-14-4-3-9-20-11-14/h3-9,11,13H,2,10,12H2,1H3 |
| InChIKey | ZJDHWQUSHFNWHY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |