C15H13NO3S — CID 165153458
prop-2-ynyl 2-(4-ethoxyphenyl)-1,3-thiazole-4-carboxylate (PubChem CID 165153458) has the molecular formula C15H13NO3S and a molecular weight of 287.34 g/mol. Its IUPAC name is prop-2-ynyl 2-(4-ethoxyphenyl)-1,3-thiazole-4-carboxylate.
| Compound Name | prop-2-ynyl 2-(4-ethoxyphenyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 165153458 |
| Molecular Formula | C15H13NO3S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | prop-2-ynyl 2-(4-ethoxyphenyl)-1,3-thiazole-4-carboxylate |
| SMILES | C#CCOC(=O)c1csc(-c2ccc(OCC)cc2)n1 |
| InChI | InChI=1S/C15H13NO3S/c1-3-9-19-15(17)13-10-20-14(16-13)11-5-7-12(8-6-11)18-4-2/h1,5-8,10H,4,9H2,2H3 |
| InChIKey | GDOJPLHZTPRSNX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|