C16H15N3O3S3 — CID 8842228
2-(4-ethylphenyl)-N'-thiophen-2-ylsulfonyl-1,3-thiazole-4-carbohydrazide (PubChem CID 8842228) has the molecular formula C16H15N3O3S3 and a molecular weight of 393.52 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-N'-thiophen-2-ylsulfonyl-1,3-thiazole-4-carbohydrazide.
| Compound Name | 2-(4-ethylphenyl)-N'-thiophen-2-ylsulfonyl-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 8842228 |
| Molecular Formula | C16H15N3O3S3 |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | 2-(4-ethylphenyl)-N'-thiophen-2-ylsulfonyl-1,3-thiazole-4-carbohydrazide |
| SMILES | CCc1ccc(-c2nc(C(=O)NNS(=O)(=O)c3cccs3)cs2)cc1 |
| InChI | InChI=1S/C16H15N3O3S3/c1-2-11-5-7-12(8-6-11)16-17-13(10-24-16)15(20)18-19-25(21,22)14-4-3-9-23-14/h3-10,19H,2H2,1H3,(H,18,20) |
| InChIKey | ACHXYJBSFXLMCK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|