C18H21N5O3S2 — CID 8842264
2-(4-ethylphenyl)-N'-(1,3,5-trimethylpyrazol-4-yl)sulfonyl-1,3-thiazole-4-carbohydrazide (PubChem CID 8842264) has the molecular formula C18H21N5O3S2 and a molecular weight of 419.53 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-N'-(1,3,5-trimethylpyrazol-4-yl)sulfonyl-1,3-thiazole-4-carbohydrazide.
| Compound Name | 2-(4-ethylphenyl)-N'-(1,3,5-trimethylpyrazol-4-yl)sulfonyl-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 8842264 |
| Molecular Formula | C18H21N5O3S2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 2-(4-ethylphenyl)-N'-(1,3,5-trimethylpyrazol-4-yl)sulfonyl-1,3-thiazole-4-carbohydrazide |
| SMILES | CCc1ccc(-c2nc(C(=O)NNS(=O)(=O)c3c(C)nn(C)c3C)cs2)cc1 |
| InChI | InChI=1S/C18H21N5O3S2/c1-5-13-6-8-14(9-7-13)18-19-15(10-27-18)17(24)20-22-28(25,26)16-11(2)21-23(4)12(16)3/h6-10,22H,5H2,1-4H3,(H,20,24) |
| InChIKey | LPZPKZLGSGOELI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|