C20H16N4OS — CID 8871536
N-[(Z)-(4-cyanophenyl)methylideneamino]-2-(4-ethylphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 8871536) has the molecular formula C20H16N4OS and a molecular weight of 360.44 g/mol. Its IUPAC name is N-[(Z)-(4-cyanophenyl)methylideneamino]-2-(4-ethylphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(Z)-(4-cyanophenyl)methylideneamino]-2-(4-ethylphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 8871536 |
| Molecular Formula | C20H16N4OS |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | N-[(Z)-(4-cyanophenyl)methylideneamino]-2-(4-ethylphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | CCc1ccc(-c2nc(C(=O)N/N=C\c3ccc(C#N)cc3)cs2)cc1 |
| InChI | InChI=1S/C20H16N4OS/c1-2-14-7-9-17(10-8-14)20-23-18(13-26-20)19(25)24-22-12-16-5-3-15(11-21)4-6-16/h3-10,12-13H,2H2,1H3,(H,24,25)/b22-12- |
| InChIKey | BPVCRDGNTNZVIZ-UUYOSTAYSA-N |
| XLogP | 4.01 |
| TPSA | 78.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|