About N-[(Z)-(4-cyanophenyl)methylideneamino]-2-(4-ethylphenyl)-1,3-thiazole-4-carboxamide
N-[(Z)-(4-cyanophenyl)methylideneamino]-2-(4-ethylphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 8871536) has the molecular formula C20H16N4OS
and a molecular weight of 360.44 g/mol. Its IUPAC name is N-[(Z)-(4-cyanophenyl)methylideneamino]-2-(4-ethylphenyl)-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | N-[(Z)-(4-cyanophenyl)methylideneamino]-2-(4-ethylphenyl)-1,3-thiazole-4-carboxamide |
| PubChem CID | 8871536 |
| Molecular Formula | C20H16N4OS |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | N-[(Z)-(4-cyanophenyl)methylideneamino]-2-(4-ethylphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | CCc1ccc(-c2nc(C(=O)N/N=C\c3ccc(C#N)cc3)cs2)cc1 |
| InChI | InChI=1S/C20H16N4OS/c1-2-14-7-9-17(10-8-14)20-23-18(13-26-20)19(25)24-22-12-16-5-3-15(11-21)4-6-16/h3-10,12-13H,2H2,1H3,(H,24,25)/b22-12- |
| InChIKey | BPVCRDGNTNZVIZ-UUYOSTAYSA-N |
| XLogP | 4.01 |
| TPSA | 78.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-(4-cyanophenyl)methylideneamino]-2-(4-ethylphenyl)-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-(4-cyanophenyl)methylideneamino]-2-(4-ethylphenyl)-1,3-thiazole-4-carboxamide?
The IUPAC name of N-[(Z)-(4-cyanophenyl)methylideneamino]-2-(4-ethylphenyl)-1,3-thiazole-4-carboxamide (CID 8871536) is N-[(Z)-(4-cyanophenyl)methylideneamino]-2-(4-ethylphenyl)-1,3-thiazole-4-carboxamide.
What is the SMILES notation for N-[(Z)-(4-cyanophenyl)methylideneamino]-2-(4-ethylphenyl)-1,3-thiazole-4-carboxamide?
The canonical SMILES for N-[(Z)-(4-cyanophenyl)methylideneamino]-2-(4-ethylphenyl)-1,3-thiazole-4-carboxamide is CCc1ccc(-c2nc(C(=O)N/N=C\c3ccc(C#N)cc3)cs2)cc1.
What is the InChIKey of N-[(Z)-(4-cyanophenyl)methylideneamino]-2-(4-ethylphenyl)-1,3-thiazole-4-carboxamide?
The InChIKey is BPVCRDGNTNZVIZ-UUYOSTAYSA-N. The full InChI is InChI=1S/C20H16N4OS/c1-2-14-7-9-17(10-8-14)20-23-18(13-26-20)19(25)24-22-12-16-5-3-15(11-21)4-6-16/h3-10,12-13H,2H2,1H3,(H,24,25)/b22-12-.
What are the key properties of N-[(Z)-(4-cyanophenyl)methylideneamino]-2-(4-ethylphenyl)-1,3-thiazole-4-carboxamide?
N-[(Z)-(4-cyanophenyl)methylideneamino]-2-(4-ethylphenyl)-1,3-thiazole-4-carboxamide has a molecular weight of 360.44 g/mol, XLogP of 4.01, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-(4-cyanophenyl)methylideneamino]-2-(4-ethylphenyl)-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 8871536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).