C21H19N3O4S — CID 8871648
2-(4-ethylphenyl)-N-[(Z)-(7-methoxy-1,3-benzodioxol-5-yl)methylideneamino]-1,3-thiazole-4-carboxamide (PubChem CID 8871648) has the molecular formula C21H19N3O4S and a molecular weight of 409.47 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-N-[(Z)-(7-methoxy-1,3-benzodioxol-5-yl)methylideneamino]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(4-ethylphenyl)-N-[(Z)-(7-methoxy-1,3-benzodioxol-5-yl)methylideneamino]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 8871648 |
| Molecular Formula | C21H19N3O4S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 2-(4-ethylphenyl)-N-[(Z)-(7-methoxy-1,3-benzodioxol-5-yl)methylideneamino]-1,3-thiazole-4-carboxamide |
| SMILES | CCc1ccc(-c2nc(C(=O)N/N=C\c3cc(OC)c4c(c3)OCO4)cs2)cc1 |
| InChI | InChI=1S/C21H19N3O4S/c1-3-13-4-6-15(7-5-13)21-23-16(11-29-21)20(25)24-22-10-14-8-17(26-2)19-18(9-14)27-12-28-19/h4-11H,3,12H2,1-2H3,(H,24,25)/b22-10- |
| InChIKey | ZCMKMTAWXGTKCJ-YVNNLAQVSA-N |
| XLogP | 3.87 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|