C19H15F2N3OS — CID 8871654
N-[(Z)-(2,4-difluorophenyl)methylideneamino]-2-(4-ethylphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 8871654) has the molecular formula C19H15F2N3OS and a molecular weight of 371.41 g/mol. Its IUPAC name is N-[(Z)-(2,4-difluorophenyl)methylideneamino]-2-(4-ethylphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(Z)-(2,4-difluorophenyl)methylideneamino]-2-(4-ethylphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 8871654 |
| Molecular Formula | C19H15F2N3OS |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | N-[(Z)-(2,4-difluorophenyl)methylideneamino]-2-(4-ethylphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | CCc1ccc(-c2nc(C(=O)N/N=C\c3ccc(F)cc3F)cs2)cc1 |
| InChI | InChI=1S/C19H15F2N3OS/c1-2-12-3-5-13(6-4-12)19-23-17(11-26-19)18(25)24-22-10-14-7-8-15(20)9-16(14)21/h3-11H,2H2,1H3,(H,24,25)/b22-10- |
| InChIKey | ITNUKDKISAOHLZ-YVNNLAQVSA-N |
| XLogP | 4.41 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|