C13H13FN2O4S2 — CID 30764484
(2-ethyl-1,3-thiazol-4-yl)methyl 2-fluoro-5-sulfamoylbenzoate (PubChem CID 30764484) has the molecular formula C13H13FN2O4S2 and a molecular weight of 344.39 g/mol. Its IUPAC name is (2-ethyl-1,3-thiazol-4-yl)methyl 2-fluoro-5-sulfamoylbenzoate.
| Compound Name | (2-ethyl-1,3-thiazol-4-yl)methyl 2-fluoro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 30764484 |
| Molecular Formula | C13H13FN2O4S2 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | (2-ethyl-1,3-thiazol-4-yl)methyl 2-fluoro-5-sulfamoylbenzoate |
| SMILES | CCc1nc(COC(=O)c2cc(S(N)(=O)=O)ccc2F)cs1 |
| InChI | InChI=1S/C13H13FN2O4S2/c1-2-12-16-8(7-21-12)6-20-13(17)10-5-9(22(15,18)19)3-4-11(10)14/h3-5,7H,2,6H2,1H3,(H2,15,18,19) |
| InChIKey | GLKSTDOTDRKSFM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |