C18H14ClFN2O4S — CID 9487702
(3-chloro-4-methylquinolin-2-yl)methyl 2-fluoro-5-sulfamoylbenzoate (PubChem CID 9487702) has the molecular formula C18H14ClFN2O4S and a molecular weight of 408.84 g/mol. Its IUPAC name is (3-chloro-4-methylquinolin-2-yl)methyl 2-fluoro-5-sulfamoylbenzoate.
| Compound Name | (3-chloro-4-methylquinolin-2-yl)methyl 2-fluoro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 9487702 |
| Molecular Formula | C18H14ClFN2O4S |
| Molecular Weight | 408.84 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | (3-chloro-4-methylquinolin-2-yl)methyl 2-fluoro-5-sulfamoylbenzoate |
| SMILES | Cc1c(Cl)c(COC(=O)c2cc(S(N)(=O)=O)ccc2F)nc2ccccc12 |
| InChI | InChI=1S/C18H14ClFN2O4S/c1-10-12-4-2-3-5-15(12)22-16(17(10)19)9-26-18(23)13-8-11(27(21,24)25)6-7-14(13)20/h2-8H,9H2,1H3,(H2,21,24,25) |
| InChIKey | LKWDXUDWVROPFL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.84 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |