C20H16ClFN2O3 — CID 71887345
(3-chloro-4-methylquinolin-2-yl)methyl 5-acetamido-2-fluorobenzoate (PubChem CID 71887345) has the molecular formula C20H16ClFN2O3 and a molecular weight of 386.81 g/mol. Its IUPAC name is (3-chloro-4-methylquinolin-2-yl)methyl 5-acetamido-2-fluorobenzoate.
| Compound Name | (3-chloro-4-methylquinolin-2-yl)methyl 5-acetamido-2-fluorobenzoate |
|---|---|
| PubChem CID | 71887345 |
| Molecular Formula | C20H16ClFN2O3 |
| Molecular Weight | 386.81 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | (3-chloro-4-methylquinolin-2-yl)methyl 5-acetamido-2-fluorobenzoate |
| SMILES | CC(=O)Nc1ccc(F)c(C(=O)OCc2nc3ccccc3c(C)c2Cl)c1 |
| InChI | InChI=1S/C20H16ClFN2O3/c1-11-14-5-3-4-6-17(14)24-18(19(11)21)10-27-20(26)15-9-13(23-12(2)25)7-8-16(15)22/h3-9H,10H2,1-2H3,(H,23,25) |
| InChIKey | FOZJRNOKTLHSLZ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.81 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |