C15H14ClNO4S — CID 7994023
(2-methylphenyl)methyl 2-chloro-5-sulfamoylbenzoate (PubChem CID 7994023) has the molecular formula C15H14ClNO4S and a molecular weight of 339.80 g/mol. Its IUPAC name is (2-methylphenyl)methyl 2-chloro-5-sulfamoylbenzoate.
| Compound Name | (2-methylphenyl)methyl 2-chloro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 7994023 |
| Molecular Formula | C15H14ClNO4S |
| Molecular Weight | 339.80 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | (2-methylphenyl)methyl 2-chloro-5-sulfamoylbenzoate |
| SMILES | Cc1ccccc1COC(=O)c1cc(S(N)(=O)=O)ccc1Cl |
| InChI | InChI=1S/C15H14ClNO4S/c1-10-4-2-3-5-11(10)9-21-15(18)13-8-12(22(17,19)20)6-7-14(13)16/h2-8H,9H2,1H3,(H2,17,19,20) |
| InChIKey | MMULHJQHDCKKSK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.80 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |